About N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride
N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride (PubChem CID 120607333) has the molecular formula C13H24ClN3O2S2
and a molecular weight of 353.94 g/mol. Its IUPAC name is N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride |
| PubChem CID | 120607333 |
| Molecular Formula | C13H24ClN3O2S2 |
| Molecular Weight | 353.94 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride |
| SMILES | Cc1nc(C)c(S(=O)(=O)NC2(CN)CCCCC2C)s1.Cl |
| InChI | InChI=1S/C13H23N3O2S2.ClH/c1-9-6-4-5-7-13(9,8-14)16-20(17,18)12-10(2)15-11(3)19-12;/h9,16H,4-8,14H2,1-3H3;1H |
| InChIKey | HGYZOZGMIQXAFK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.94 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride?
The IUPAC name of N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride (CID 120607333) is N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride.
What is the SMILES notation for N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride?
The canonical SMILES for N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride is Cc1nc(C)c(S(=O)(=O)NC2(CN)CCCCC2C)s1.Cl.
What is the InChIKey of N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride?
The InChIKey is HGYZOZGMIQXAFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2S2.ClH/c1-9-6-4-5-7-13(9,8-14)16-20(17,18)12-10(2)15-11(3)19-12;/h9,16H,4-8,14H2,1-3H3;1H.
What are the key properties of N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride?
N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride has a molecular weight of 353.94 g/mol, XLogP of 2.37, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(aminomethyl)-2-methylcyclohexyl]-2,4-dimethyl-1,3-thiazole-5-sulfonamide;hydrochloride is sourced from PubChem (CID 120607333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).