C11H17FN2O — CID 120607745
(2R,4S)-4-fluoro-N,N-bis(prop-2-enyl)pyrrolidine-2-carboxamide (PubChem CID 120607745) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is (2R,4S)-4-fluoro-N,N-bis(prop-2-enyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-4-fluoro-N,N-bis(prop-2-enyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 120607745 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (2R,4S)-4-fluoro-N,N-bis(prop-2-enyl)pyrrolidine-2-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)[C@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C11H17FN2O/c1-3-5-14(6-4-2)11(15)10-7-9(12)8-13-10/h3-4,9-10,13H,1-2,5-8H2/t9-,10+/m0/s1 |
| InChIKey | DDCQDKGQEWEXNV-VHSXEESVSA-N |
| XLogP | 0.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|