C17H15F6NO3S — CID 1206091
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 1206091) has the molecular formula C17H15F6NO3S and a molecular weight of 427.37 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 1206091 |
| Molecular Formula | C17H15F6NO3S |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H15F6NO3S/c1-11-3-9-14(10-4-11)28(26,27)24(2)13-7-5-12(6-8-13)15(25,16(18,19)20)17(21,22)23/h3-10,25H,1-2H3 |
| InChIKey | OJFMUQSBPCFBCM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |