About 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide
2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide (PubChem CID 12060922) has the molecular formula C19H15NO2S
and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide.
Molecular Properties
| Compound Name | 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide |
| PubChem CID | 12060922 |
| Molecular Formula | C19H15NO2S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide |
| SMILES | O=S1c2ccccc2C(c2ccccc2)(c2ccccc2)N1O |
| InChI | InChI=1S/C19H15NO2S/c21-20-19(15-9-3-1-4-10-15,16-11-5-2-6-12-16)17-13-7-8-14-18(17)23(20)22/h1-14,21H |
| InChIKey | QFXSLIXLMOTGSI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide?
The IUPAC name of 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide (CID 12060922) is 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide.
What is the SMILES notation for 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide?
The canonical SMILES for 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide is O=S1c2ccccc2C(c2ccccc2)(c2ccccc2)N1O.
What is the InChIKey of 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide?
The InChIKey is QFXSLIXLMOTGSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO2S/c21-20-19(15-9-3-1-4-10-15,16-11-5-2-6-12-16)17-13-7-8-14-18(17)23(20)22/h1-14,21H.
What are the key properties of 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide?
2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide has a molecular weight of 321.40 g/mol, XLogP of 3.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,3-diphenyl-1,2-benzothiazole 1-oxide is sourced from PubChem (CID 12060922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).