C19H24N2O — CID 120609604
3-(2-aminophenyl)-N-(3,5-dimethylphenyl)-N-ethylpropanamide (PubChem CID 120609604) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-(3,5-dimethylphenyl)-N-ethylpropanamide.
| Compound Name | 3-(2-aminophenyl)-N-(3,5-dimethylphenyl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 120609604 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 3-(2-aminophenyl)-N-(3,5-dimethylphenyl)-N-ethylpropanamide |
| SMILES | CCN(C(=O)CCc1ccccc1N)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C19H24N2O/c1-4-21(17-12-14(2)11-15(3)13-17)19(22)10-9-16-7-5-6-8-18(16)20/h5-8,11-13H,4,9-10,20H2,1-3H3 |
| InChIKey | DRKYAWRFNQIQKL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|