About 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one
2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one (PubChem CID 12060981) has the molecular formula C9H9NO2Se
and a molecular weight of 242.14 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one.
Molecular Properties
| Compound Name | 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one |
| PubChem CID | 12060981 |
| Molecular Formula | C9H9NO2Se |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one |
| SMILES | O=c1c2ccccc2[se]n1CCO |
| InChI | InChI=1S/C9H9NO2Se/c11-6-5-10-9(12)7-3-1-2-4-8(7)13-10/h1-4,11H,5-6H2 |
| InChIKey | INJSPYUOTZNFSF-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one?
The IUPAC name of 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one (CID 12060981) is 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one.
What is the SMILES notation for 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one?
The canonical SMILES for 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one is O=c1c2ccccc2[se]n1CCO.
What is the InChIKey of 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one?
The InChIKey is INJSPYUOTZNFSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2Se/c11-6-5-10-9(12)7-3-1-2-4-8(7)13-10/h1-4,11H,5-6H2.
What are the key properties of 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one?
2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one has a molecular weight of 242.14 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethyl)-1,2-benzoselenazol-3-one is sourced from PubChem (CID 12060981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).