C20H24ClN3O — CID 120610465
3-(2-aminophenyl)-N-[2-(4-methyl-1H-indol-3-yl)ethyl]propanamide;hydrochloride (PubChem CID 120610465) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[2-(4-methyl-1H-indol-3-yl)ethyl]propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[2-(4-methyl-1H-indol-3-yl)ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120610465 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-(2-aminophenyl)-N-[2-(4-methyl-1H-indol-3-yl)ethyl]propanamide;hydrochloride |
| SMILES | Cc1cccc2[nH]cc(CCNC(=O)CCc3ccccc3N)c12.Cl |
| InChI | InChI=1S/C20H23N3O.ClH/c1-14-5-4-8-18-20(14)16(13-23-18)11-12-22-19(24)10-9-15-6-2-3-7-17(15)21;/h2-8,13,23H,9-12,21H2,1H3,(H,22,24);1H |
| InChIKey | WLNLNYXKOWTSCS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|