C15H24ClN3O3S2 — CID 120610539
3-(2-aminophenyl)-N-(2-thiomorpholin-4-ylsulfonylethyl)propanamide;hydrochloride (PubChem CID 120610539) has the molecular formula C15H24ClN3O3S2 and a molecular weight of 393.96 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-(2-thiomorpholin-4-ylsulfonylethyl)propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-(2-thiomorpholin-4-ylsulfonylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120610539 |
| Molecular Formula | C15H24ClN3O3S2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 3-(2-aminophenyl)-N-(2-thiomorpholin-4-ylsulfonylethyl)propanamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1CCC(=O)NCCS(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C15H23N3O3S2.ClH/c16-14-4-2-1-3-13(14)5-6-15(19)17-7-12-23(20,21)18-8-10-22-11-9-18;/h1-4H,5-12,16H2,(H,17,19);1H |
| InChIKey | KYEMIYGEOBTMQH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|