C16H25ClN2O — CID 120610600
3-(2-aminophenyl)-N-(4-methylcyclohexyl)propanamide;hydrochloride (PubChem CID 120610600) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-(4-methylcyclohexyl)propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-(4-methylcyclohexyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120610600 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-(2-aminophenyl)-N-(4-methylcyclohexyl)propanamide;hydrochloride |
| SMILES | CC1CCC(NC(=O)CCc2ccccc2N)CC1.Cl |
| InChI | InChI=1S/C16H24N2O.ClH/c1-12-6-9-14(10-7-12)18-16(19)11-8-13-4-2-3-5-15(13)17;/h2-5,12,14H,6-11,17H2,1H3,(H,18,19);1H |
| InChIKey | YTOSVGRDTDMLCF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|