C20H24ClF3N2O — CID 120611397
3-(2-aminophenyl)-N-[2-(4-methylphenyl)ethyl]-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride (PubChem CID 120611397) has the molecular formula C20H24ClF3N2O and a molecular weight of 400.87 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[2-(4-methylphenyl)ethyl]-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[2-(4-methylphenyl)ethyl]-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120611397 |
| Molecular Formula | C20H24ClF3N2O |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-(2-aminophenyl)-N-[2-(4-methylphenyl)ethyl]-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride |
| SMILES | Cc1ccc(CCN(CC(F)(F)F)C(=O)CCc2ccccc2N)cc1.Cl |
| InChI | InChI=1S/C20H23F3N2O.ClH/c1-15-6-8-16(9-7-15)12-13-25(14-20(21,22)23)19(26)11-10-17-4-2-3-5-18(17)24;/h2-9H,10-14,24H2,1H3;1H |
| InChIKey | UNAFABAFFYNPHK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|