C17H20N2O2S — CID 120611548
3-(2-aminophenyl)-1-(2-thiophen-3-ylmorpholin-4-yl)propan-1-one (PubChem CID 120611548) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-(2-thiophen-3-ylmorpholin-4-yl)propan-1-one.
| Compound Name | 3-(2-aminophenyl)-1-(2-thiophen-3-ylmorpholin-4-yl)propan-1-one |
|---|---|
| PubChem CID | 120611548 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3-(2-aminophenyl)-1-(2-thiophen-3-ylmorpholin-4-yl)propan-1-one |
| SMILES | Nc1ccccc1CCC(=O)N1CCOC(c2ccsc2)C1 |
| InChI | InChI=1S/C17H20N2O2S/c18-15-4-2-1-3-13(15)5-6-17(20)19-8-9-21-16(11-19)14-7-10-22-12-14/h1-4,7,10,12,16H,5-6,8-9,11,18H2 |
| InChIKey | VFFYQYDUGFMTAN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|