C18H22ClN3O3 — CID 120611695
3-(2-aminophenyl)-N-[1-(3-nitrophenyl)propyl]propanamide;hydrochloride (PubChem CID 120611695) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[1-(3-nitrophenyl)propyl]propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[1-(3-nitrophenyl)propyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120611695 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-(2-aminophenyl)-N-[1-(3-nitrophenyl)propyl]propanamide;hydrochloride |
| SMILES | CCC(NC(=O)CCc1ccccc1N)c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C18H21N3O3.ClH/c1-2-17(14-7-5-8-15(12-14)21(23)24)20-18(22)11-10-13-6-3-4-9-16(13)19;/h3-9,12,17H,2,10-11,19H2,1H3,(H,20,22);1H |
| InChIKey | BADOWFGTAGGOGQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|