C10H16F3NO3 — CID 120614475
(2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid (PubChem CID 120614475) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 120614475 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)C(C)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H16F3NO3/c1-3-4-5-7(9(16)17)14-8(15)6(2)10(11,12)13/h6-7H,3-5H2,1-2H3,(H,14,15)(H,16,17)/t6?,7-/m0/s1 |
| InChIKey | STZFFZWGSZNKCS-MLWJPKLSSA-N |
| XLogP | 1.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |