(2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid

C10H16F3NO3 — CID 120614475

IUPAC(2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid
SMILESCCCC[C@H](NC(=O)C(C)C(F)(F)F)C(=O)O
InChIInChI=1S/C10H16F3NO3/c1-3-4-5-7(9(16)17)14-8(15)6(2)10(11,12)13/h6-7H,3-5H2,1-2H3,(H,14,15)(H,16,17)/t6?,7-/m0/s1
InChIKeySTZFFZWGSZNKCS-MLWJPKLSSA-N
MW255.24 g/mol
LogP1.94
Rot. Bonds6

About (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid

(2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid (PubChem CID 120614475) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid.

Molecular Properties

Compound Name(2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid
PubChem CID120614475
Molecular FormulaC10H16F3NO3
Molecular Weight255.24 g/mol
Exact Mass255.11
IUPAC Name(2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid
SMILESCCCC[C@H](NC(=O)C(C)C(F)(F)F)C(=O)O
InChIInChI=1S/C10H16F3NO3/c1-3-4-5-7(9(16)17)14-8(15)6(2)10(11,12)13/h6-7H,3-5H2,1-2H3,(H,14,15)(H,16,17)/t6?,7-/m0/s1
InChIKeySTZFFZWGSZNKCS-MLWJPKLSSA-N
XLogP1.94
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.24
LogP ≤ 51.94
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid?
The IUPAC name of (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid (CID 120614475) is (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid.
What is the SMILES notation for (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid?
The canonical SMILES for (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid is CCCC[C@H](NC(=O)C(C)C(F)(F)F)C(=O)O.
What is the InChIKey of (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid?
The InChIKey is STZFFZWGSZNKCS-MLWJPKLSSA-N. The full InChI is InChI=1S/C10H16F3NO3/c1-3-4-5-7(9(16)17)14-8(15)6(2)10(11,12)13/h6-7H,3-5H2,1-2H3,(H,14,15)(H,16,17)/t6?,7-/m0/s1.
What are the key properties of (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid?
(2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid has a molecular weight of 255.24 g/mol, XLogP of 1.94, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(3,3,3-trifluoro-2-methylpropanoyl)amino]hexanoic acid is sourced from PubChem (CID 120614475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).