C21H32N2O3 — CID 120614792
(2S)-2-[2-(4-benzylpiperidin-1-yl)propanoylamino]hexanoic acid (PubChem CID 120614792) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is (2S)-2-[2-(4-benzylpiperidin-1-yl)propanoylamino]hexanoic acid.
| Compound Name | (2S)-2-[2-(4-benzylpiperidin-1-yl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 120614792 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | (2S)-2-[2-(4-benzylpiperidin-1-yl)propanoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)C(C)N1CCC(Cc2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C21H32N2O3/c1-3-4-10-19(21(25)26)22-20(24)16(2)23-13-11-18(12-14-23)15-17-8-6-5-7-9-17/h5-9,16,18-19H,3-4,10-15H2,1-2H3,(H,22,24)(H,25,26)/t16?,19-/m0/s1 |
| InChIKey | XQPAAKOPPAUMIV-CVMIBEPCSA-N |
| XLogP | 3.09 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |