C14H17F3N2O4 — CID 120615249
(2S)-2-[[2-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]hexanoic acid (PubChem CID 120615249) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is (2S)-2-[[2-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120615249 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (2S)-2-[[2-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)c1cccnc1OCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H17F3N2O4/c1-2-3-6-10(13(21)22)19-11(20)9-5-4-7-18-12(9)23-8-14(15,16)17/h4-5,7,10H,2-3,6,8H2,1H3,(H,19,20)(H,21,22)/t10-/m0/s1 |
| InChIKey | ULYDKJVMMWXBGP-JTQLQIEISA-N |
| XLogP | 2.40 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |