C17H20N2O3 — CID 120615508
(2S)-2-[(4-phenyl-1H-pyrrole-3-carbonyl)amino]hexanoic acid (PubChem CID 120615508) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is (2S)-2-[(4-phenyl-1H-pyrrole-3-carbonyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(4-phenyl-1H-pyrrole-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 120615508 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (2S)-2-[(4-phenyl-1H-pyrrole-3-carbonyl)amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)c1c[nH]cc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H20N2O3/c1-2-3-9-15(17(21)22)19-16(20)14-11-18-10-13(14)12-7-5-4-6-8-12/h4-8,10-11,15,18H,2-3,9H2,1H3,(H,19,20)(H,21,22)/t15-/m0/s1 |
| InChIKey | WPVNKADYCLZKQR-HNNXBMFYSA-N |
| XLogP | 3.05 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |