C18H33N3O4 — CID 120615595
(2S)-2-[[2-[1-(2-methylpropylcarbamoyl)piperidin-3-yl]acetyl]amino]hexanoic acid (PubChem CID 120615595) has the molecular formula C18H33N3O4 and a molecular weight of 355.48 g/mol. Its IUPAC name is (2S)-2-[[2-[1-(2-methylpropylcarbamoyl)piperidin-3-yl]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-[1-(2-methylpropylcarbamoyl)piperidin-3-yl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120615595 |
| Molecular Formula | C18H33N3O4 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (2S)-2-[[2-[1-(2-methylpropylcarbamoyl)piperidin-3-yl]acetyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CC1CCCN(C(=O)NCC(C)C)C1)C(=O)O |
| InChI | InChI=1S/C18H33N3O4/c1-4-5-8-15(17(23)24)20-16(22)10-14-7-6-9-21(12-14)18(25)19-11-13(2)3/h13-15H,4-12H2,1-3H3,(H,19,25)(H,20,22)(H,23,24)/t14?,15-/m0/s1 |
| InChIKey | QXRRJNQZAWKUDJ-LOACHALJSA-N |
| XLogP | 2.21 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |