C38H42Si2 — CID 12061715
(13,22-ditert-butyl-6-trimethylsilyl-5-tetracyclo[18.4.0.04,7.010,15]tetracosa-1,2,3,5,7,8,9,11,13,15,16,17,18,19,21,23-hexadecaenyl)-trimethylsilane (PubChem CID 12061715) has the molecular formula C38H42Si2 and a molecular weight of 554.93 g/mol. Its IUPAC name is (13,22-ditert-butyl-6-trimethylsilyl-5-tetracyclo[18.4.0.04,7.010,15]tetracosa-1,2,3,5,7,8,9,11,13,15,16,17,18,19,21,23-hexadecaenyl)-trimethylsilane.
| Compound Name | (13,22-ditert-butyl-6-trimethylsilyl-5-tetracyclo[18.4.0.04,7.010,15]tetracosa-1,2,3,5,7,8,9,11,13,15,16,17,18,19,21,23-hexadecaenyl)-trimethylsilane |
|---|---|
| PubChem CID | 12061715 |
| Molecular Formula | C38H42Si2 |
| Molecular Weight | 554.93 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | (13,22-ditert-butyl-6-trimethylsilyl-5-tetracyclo[18.4.0.04,7.010,15]tetracosa-1,2,3,5,7,8,9,11,13,15,16,17,18,19,21,23-hexadecaenyl)-trimethylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)=C=C=C=C=c1cc(C(C)(C)C)ccc1=C=C=C1C(=C=C=2)C([Si](C)(C)C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C38H42Si2/c1-37(2,3)31-21-17-27-19-23-33-34(36(40(10,11)12)35(33)39(7,8)9)24-20-28-18-22-32(38(4,5)6)26-30(28)16-14-13-15-29(27)25-31/h17-18,21-22,25-26H,1-12H3 |
| InChIKey | IUUSKBXZQFAOQI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.93 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|