C21H22F3NO6 — CID 12061735
[(1R,2S)-1-(4-methoxyphenyl)-2-nitrobutyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 12061735) has the molecular formula C21H22F3NO6 and a molecular weight of 441.40 g/mol. Its IUPAC name is [(1R,2S)-1-(4-methoxyphenyl)-2-nitrobutyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1R,2S)-1-(4-methoxyphenyl)-2-nitrobutyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 12061735 |
| Molecular Formula | C21H22F3NO6 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | [(1R,2S)-1-(4-methoxyphenyl)-2-nitrobutyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CC[C@@H]([C@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)c1ccc(OC)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C21H22F3NO6/c1-4-17(25(27)28)18(14-10-12-16(29-2)13-11-14)31-19(26)20(30-3,21(22,23)24)15-8-6-5-7-9-15/h5-13,17-18H,4H2,1-3H3/t17-,18+,20-/m0/s1 |
| InChIKey | YZHUISONGUVNPC-NSHGMRRFSA-N |
| XLogP | 4.44 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|