C21H19F3N2O5 — CID 12061736
[(1R,2S)-1-(4-cyanophenyl)-2-nitrobutyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 12061736) has the molecular formula C21H19F3N2O5 and a molecular weight of 436.39 g/mol. Its IUPAC name is [(1R,2S)-1-(4-cyanophenyl)-2-nitrobutyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1R,2S)-1-(4-cyanophenyl)-2-nitrobutyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 12061736 |
| Molecular Formula | C21H19F3N2O5 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | [(1R,2S)-1-(4-cyanophenyl)-2-nitrobutyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CC[C@@H]([C@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)c1ccc(C#N)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C21H19F3N2O5/c1-3-17(26(28)29)18(15-11-9-14(13-25)10-12-15)31-19(27)20(30-2,21(22,23)24)16-7-5-4-6-8-16/h4-12,17-18H,3H2,1-2H3/t17-,18+,20-/m0/s1 |
| InChIKey | VCVYZKVHCKHWAI-NSHGMRRFSA-N |
| XLogP | 4.30 |
| TPSA | 102.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|