C20H19F3N2O7 — CID 12061738
[(1R,2S)-2-nitro-1-(3-nitrophenyl)butyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 12061738) has the molecular formula C20H19F3N2O7 and a molecular weight of 456.37 g/mol. Its IUPAC name is [(1R,2S)-2-nitro-1-(3-nitrophenyl)butyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1R,2S)-2-nitro-1-(3-nitrophenyl)butyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 12061738 |
| Molecular Formula | C20H19F3N2O7 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | [(1R,2S)-2-nitro-1-(3-nitrophenyl)butyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CC[C@@H]([C@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)c1cccc([N+](=O)[O-])c1)[N+](=O)[O-] |
| InChI | InChI=1S/C20H19F3N2O7/c1-3-16(25(29)30)17(13-8-7-11-15(12-13)24(27)28)32-18(26)19(31-2,20(21,22)23)14-9-5-4-6-10-14/h4-12,16-17H,3H2,1-2H3/t16-,17+,19-/m0/s1 |
| InChIKey | HHYRLKKYZTVNCR-SCTDSRPQSA-N |
| XLogP | 4.34 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|