C12H21ClN4O2 — CID 120618740
4-(methoxymethyl)-N-(1-methylpyrazol-3-yl)piperidine-4-carboxamide;hydrochloride (PubChem CID 120618740) has the molecular formula C12H21ClN4O2 and a molecular weight of 288.78 g/mol. Its IUPAC name is 4-(methoxymethyl)-N-(1-methylpyrazol-3-yl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-(methoxymethyl)-N-(1-methylpyrazol-3-yl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120618740 |
| Molecular Formula | C12H21ClN4O2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-(methoxymethyl)-N-(1-methylpyrazol-3-yl)piperidine-4-carboxamide;hydrochloride |
| SMILES | COCC1(C(=O)Nc2ccn(C)n2)CCNCC1.Cl |
| InChI | InChI=1S/C12H20N4O2.ClH/c1-16-8-3-10(15-16)14-11(17)12(9-18-2)4-6-13-7-5-12;/h3,8,13H,4-7,9H2,1-2H3,(H,14,15,17);1H |
| InChIKey | BYHREVGKHJWTQO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |