C15H28N2O — CID 120619148
(2S,4S)-N-cycloheptyl-N,2-dimethylpiperidine-4-carboxamide (PubChem CID 120619148) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (2S,4S)-N-cycloheptyl-N,2-dimethylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-cycloheptyl-N,2-dimethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120619148 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (2S,4S)-N-cycloheptyl-N,2-dimethylpiperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)N(C)C2CCCCCC2)CCN1 |
| InChI | InChI=1S/C15H28N2O/c1-12-11-13(9-10-16-12)15(18)17(2)14-7-5-3-4-6-8-14/h12-14,16H,3-11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | AAHBFANRVBSMBN-STQMWFEESA-N |
| XLogP | 2.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |