C17H23N3O2 — CID 120619355
(2S,4S)-N-[4-(cyclopropylcarbamoyl)phenyl]-2-methylpiperidine-4-carboxamide (PubChem CID 120619355) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (2S,4S)-N-[4-(cyclopropylcarbamoyl)phenyl]-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-[4-(cyclopropylcarbamoyl)phenyl]-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120619355 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (2S,4S)-N-[4-(cyclopropylcarbamoyl)phenyl]-2-methylpiperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)Nc2ccc(C(=O)NC3CC3)cc2)CCN1 |
| InChI | InChI=1S/C17H23N3O2/c1-11-10-13(8-9-18-11)17(22)20-14-4-2-12(3-5-14)16(21)19-15-6-7-15/h2-5,11,13,15,18H,6-10H2,1H3,(H,19,21)(H,20,22)/t11-,13-/m0/s1 |
| InChIKey | WTSBEOIWGYJFSC-AAEUAGOBSA-N |
| XLogP | 1.91 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |