C20H29ClN2O3 — CID 120619483
[1-[4-(methoxymethyl)piperidine-4-carbonyl]piperidin-4-yl]-phenylmethanone;hydrochloride (PubChem CID 120619483) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is [1-[4-(methoxymethyl)piperidine-4-carbonyl]piperidin-4-yl]-phenylmethanone;hydrochloride.
| Compound Name | [1-[4-(methoxymethyl)piperidine-4-carbonyl]piperidin-4-yl]-phenylmethanone;hydrochloride |
|---|---|
| PubChem CID | 120619483 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | [1-[4-(methoxymethyl)piperidine-4-carbonyl]piperidin-4-yl]-phenylmethanone;hydrochloride |
| SMILES | COCC1(C(=O)N2CCC(C(=O)c3ccccc3)CC2)CCNCC1.Cl |
| InChI | InChI=1S/C20H28N2O3.ClH/c1-25-15-20(9-11-21-12-10-20)19(24)22-13-7-17(8-14-22)18(23)16-5-3-2-4-6-16;/h2-6,17,21H,7-15H2,1H3;1H |
| InChIKey | WSWWIGPQCKLFAA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |