C23H33ClN2O3 — CID 120619510
[(2S,4S)-2-methylpiperidin-4-yl]-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone;hydrochloride (PubChem CID 120619510) has the molecular formula C23H33ClN2O3 and a molecular weight of 420.98 g/mol. Its IUPAC name is [(2S,4S)-2-methylpiperidin-4-yl]-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone;hydrochloride.
| Compound Name | [(2S,4S)-2-methylpiperidin-4-yl]-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120619510 |
| Molecular Formula | C23H33ClN2O3 |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | [(2S,4S)-2-methylpiperidin-4-yl]-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone;hydrochloride |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1C(=O)[C@H]1CCN[C@@H](C)C1)OCCO3.Cl |
| InChI | InChI=1S/C23H32N2O3.ClH/c1-15-11-17(5-8-24-15)22(26)25-14-23(6-3-4-7-23)19-13-21-20(27-9-10-28-21)12-18(19)16(25)2;/h12-13,15-17,24H,3-11,14H2,1-2H3;1H/t15-,16?,17-;/m0./s1 |
| InChIKey | FNCZXGLXZPXVBZ-MICXNEOXSA-N |
| XLogP | 3.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |