About methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate
methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 120619653) has the molecular formula C15H26N2O3
and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate |
| PubChem CID | 120619653 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)[C@H]2CCN[C@@H](C)C2)CCCCC1 |
| InChI | InChI=1S/C15H26N2O3/c1-11-10-12(6-9-16-11)13(18)17-15(14(19)20-2)7-4-3-5-8-15/h11-12,16H,3-10H2,1-2H3,(H,17,18)/t11-,12-/m0/s1 |
| InChIKey | OLOFRVYZZDEKAE-RYUDHWBXSA-N |
| XLogP | 1.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate?
The IUPAC name of methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate (CID 120619653) is methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate is COC(=O)C1(NC(=O)[C@H]2CCN[C@@H](C)C2)CCCCC1.
What is the InChIKey of methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate?
The InChIKey is OLOFRVYZZDEKAE-RYUDHWBXSA-N. The full InChI is InChI=1S/C15H26N2O3/c1-11-10-12(6-9-16-11)13(18)17-15(14(19)20-2)7-4-3-5-8-15/h11-12,16H,3-10H2,1-2H3,(H,17,18)/t11-,12-/m0/s1.
What are the key properties of methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate?
methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate has a molecular weight of 282.38 g/mol, XLogP of 1.37, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[(2S,4S)-2-methylpiperidine-4-carbonyl]amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 120619653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).