C18H27N3O5S — CID 120619738
N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-4-(methoxymethyl)piperidine-4-carboxamide (PubChem CID 120619738) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-4-(methoxymethyl)piperidine-4-carboxamide.
| Compound Name | N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-4-(methoxymethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120619738 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-4-(methoxymethyl)piperidine-4-carboxamide |
| SMILES | COCC1(C(=O)Nc2cc(S(=O)(=O)NC3CC3)ccc2OC)CCNCC1 |
| InChI | InChI=1S/C18H27N3O5S/c1-25-12-18(7-9-19-10-8-18)17(22)20-15-11-14(5-6-16(15)26-2)27(23,24)21-13-3-4-13/h5-6,11,13,19,21H,3-4,7-10,12H2,1-2H3,(H,20,22) |
| InChIKey | NCTPGUNFEXWUHQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |