About 3,5-diaminobenzoic acid
3,5-diaminobenzoic acid (PubChem CID 12062) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 3,5-diaminobenzoic acid.
Molecular Properties
| Compound Name | 3,5-diaminobenzoic acid |
| PubChem CID | 12062 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 3,5-diaminobenzoic acid |
| SMILES | Nc1cc(N)cc(C(=O)O)c1 |
| InChI | InChI=1S/C7H8N2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,8-9H2,(H,10,11) |
| InChIKey | UENRXLSRMCSUSN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diaminobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diaminobenzoic acid?
The IUPAC name of 3,5-diaminobenzoic acid (CID 12062) is 3,5-diaminobenzoic acid.
What is the SMILES notation for 3,5-diaminobenzoic acid?
The canonical SMILES for 3,5-diaminobenzoic acid is Nc1cc(N)cc(C(=O)O)c1.
What is the InChIKey of 3,5-diaminobenzoic acid?
The InChIKey is UENRXLSRMCSUSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,8-9H2,(H,10,11).
What are the key properties of 3,5-diaminobenzoic acid?
3,5-diaminobenzoic acid has a molecular weight of 152.15 g/mol, XLogP of 0.55, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diaminobenzoic acid is sourced from PubChem (CID 12062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).