C11H20N2OS — CID 120620099
[(2S,4S)-2-methylpiperidin-4-yl]-thiomorpholin-4-ylmethanone (PubChem CID 120620099) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is [(2S,4S)-2-methylpiperidin-4-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [(2S,4S)-2-methylpiperidin-4-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 120620099 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | [(2S,4S)-2-methylpiperidin-4-yl]-thiomorpholin-4-ylmethanone |
| SMILES | C[C@H]1C[C@@H](C(=O)N2CCSCC2)CCN1 |
| InChI | InChI=1S/C11H20N2OS/c1-9-8-10(2-3-12-9)11(14)13-4-6-15-7-5-13/h9-10,12H,2-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | CDEXSJUZUPWGNL-UWVGGRQHSA-N |
| XLogP | 0.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |