C10H17F3N2OS — CID 120622905
(2S,4S)-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-4-carboxamide (PubChem CID 120622905) has the molecular formula C10H17F3N2OS and a molecular weight of 270.32 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-4-carboxamide.
| Compound Name | (2S,4S)-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120622905 |
| Molecular Formula | C10H17F3N2OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (2S,4S)-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)NCCSC(F)(F)F)CCN1 |
| InChI | InChI=1S/C10H17F3N2OS/c1-7-6-8(2-3-14-7)9(16)15-4-5-17-10(11,12)13/h7-8,14H,2-6H2,1H3,(H,15,16)/t7-,8-/m0/s1 |
| InChIKey | JQGKPWUVYPDZQE-YUMQZZPRSA-N |
| XLogP | 1.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|