C19H28N2O2 — CID 120623333
(2S,4S)-2-methyl-N-[(4-phenyloxan-4-yl)methyl]piperidine-4-carboxamide (PubChem CID 120623333) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-[(4-phenyloxan-4-yl)methyl]piperidine-4-carboxamide.
| Compound Name | (2S,4S)-2-methyl-N-[(4-phenyloxan-4-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120623333 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (2S,4S)-2-methyl-N-[(4-phenyloxan-4-yl)methyl]piperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)NCC2(c3ccccc3)CCOCC2)CCN1 |
| InChI | InChI=1S/C19H28N2O2/c1-15-13-16(7-10-20-15)18(22)21-14-19(8-11-23-12-9-19)17-5-3-2-4-6-17/h2-6,15-16,20H,7-14H2,1H3,(H,21,22)/t15-,16-/m0/s1 |
| InChIKey | JLERQXMLTTTZFC-HOTGVXAUSA-N |
| XLogP | 2.24 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |