C19H28ClF3N2O2 — CID 120624510
(2S,4S)-N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N,2-dimethylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120624510) has the molecular formula C19H28ClF3N2O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is (2S,4S)-N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N,2-dimethylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N,2-dimethylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120624510 |
| Molecular Formula | C19H28ClF3N2O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (2S,4S)-N-[[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N,2-dimethylpiperidine-4-carboxamide;hydrochloride |
| SMILES | Cc1cc(CN(C)C(=O)[C@H]2CCN[C@@H](C)C2)cc(C)c1OCC(F)(F)F.Cl |
| InChI | InChI=1S/C19H27F3N2O2.ClH/c1-12-7-15(8-13(2)17(12)26-11-19(20,21)22)10-24(4)18(25)16-5-6-23-14(3)9-16;/h7-8,14,16,23H,5-6,9-11H2,1-4H3;1H/t14-,16-;/m0./s1 |
| InChIKey | BHUUGRUVBAHIOX-DMLYUBSXSA-N |
| XLogP | 4.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |