C22H28ClN3O3 — CID 120624537
N-(3-benzamido-2-methylphenyl)-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 120624537) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is N-(3-benzamido-2-methylphenyl)-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(3-benzamido-2-methylphenyl)-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120624537 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-(3-benzamido-2-methylphenyl)-4-(methoxymethyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | COCC1(C(=O)Nc2cccc(NC(=O)c3ccccc3)c2C)CCNCC1.Cl |
| InChI | InChI=1S/C22H27N3O3.ClH/c1-16-18(24-20(26)17-7-4-3-5-8-17)9-6-10-19(16)25-21(27)22(15-28-2)11-13-23-14-12-22;/h3-10,23H,11-15H2,1-2H3,(H,24,26)(H,25,27);1H |
| InChIKey | SFPWFLTUYRTFMQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |