C15H20N4OS2 — CID 120624911
2-(2-aminoethyl)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 120624911) has the molecular formula C15H20N4OS2 and a molecular weight of 336.49 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-aminoethyl)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 120624911 |
| Molecular Formula | C15H20N4OS2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-(2-aminoethyl)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | NCCc1nc(C(=O)Nc2nc3c(s2)CCCCCC3)cs1 |
| InChI | InChI=1S/C15H20N4OS2/c16-8-7-13-17-11(9-21-13)14(20)19-15-18-10-5-3-1-2-4-6-12(10)22-15/h9H,1-8,16H2,(H,18,19,20) |
| InChIKey | VUGSEBDFUYLGJZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |