C19H26O5 — CID 12062504
[(4R,6S,7S,11R)-10-hexyl-11-methyl-2,9-dioxo-8-oxatricyclo[5.3.1.04,11]undec-1(10)-en-6-yl] acetate (PubChem CID 12062504) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is [(4R,6S,7S,11R)-10-hexyl-11-methyl-2,9-dioxo-8-oxatricyclo[5.3.1.04,11]undec-1(10)-en-6-yl] acetate.
| Compound Name | [(4R,6S,7S,11R)-10-hexyl-11-methyl-2,9-dioxo-8-oxatricyclo[5.3.1.04,11]undec-1(10)-en-6-yl] acetate |
|---|---|
| PubChem CID | 12062504 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(4R,6S,7S,11R)-10-hexyl-11-methyl-2,9-dioxo-8-oxatricyclo[5.3.1.04,11]undec-1(10)-en-6-yl] acetate |
| SMILES | CCCCCCC1=C2C(=O)C[C@H]3C[C@H](OC(C)=O)[C@@H](OC1=O)[C@@]23C |
| InChI | InChI=1S/C19H26O5/c1-4-5-6-7-8-13-16-14(21)9-12-10-15(23-11(2)20)17(19(12,16)3)24-18(13)22/h12,15,17H,4-10H2,1-3H3/t12-,15-,17+,19+/m0/s1 |
| InChIKey | DDQZFHKJVMQIAE-FAAYRAOTSA-N |
| XLogP | 3.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|