C16H30ClN3OS — CID 120626179
2-(2-aminoethyl)-N-pentan-2-yl-N-pentyl-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 120626179) has the molecular formula C16H30ClN3OS and a molecular weight of 347.96 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-pentan-2-yl-N-pentyl-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(2-aminoethyl)-N-pentan-2-yl-N-pentyl-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120626179 |
| Molecular Formula | C16H30ClN3OS |
| Molecular Weight | 347.96 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-(2-aminoethyl)-N-pentan-2-yl-N-pentyl-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | CCCCCN(C(=O)c1csc(CCN)n1)C(C)CCC.Cl |
| InChI | InChI=1S/C16H29N3OS.ClH/c1-4-6-7-11-19(13(3)8-5-2)16(20)14-12-21-15(18-14)9-10-17;/h12-13H,4-11,17H2,1-3H3;1H |
| InChIKey | YJTJAHNQHFSYHP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.96 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|