C18H19ClFNO4 — CID 120626543
(3aS,7aS)-2-[2-(2-chloro-6-fluorophenyl)cyclopropanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120626543) has the molecular formula C18H19ClFNO4 and a molecular weight of 367.80 g/mol. Its IUPAC name is (3aS,7aS)-2-[2-(2-chloro-6-fluorophenyl)cyclopropanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[2-(2-chloro-6-fluorophenyl)cyclopropanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120626543 |
| Molecular Formula | C18H19ClFNO4 |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (3aS,7aS)-2-[2-(2-chloro-6-fluorophenyl)cyclopropanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(C1CC1c1c(F)cccc1Cl)N1C[C@H]2COCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C18H19ClFNO4/c19-13-2-1-3-14(20)15(13)11-6-12(11)16(22)21-7-10-8-25-5-4-18(10,9-21)17(23)24/h1-3,10-12H,4-9H2,(H,23,24)/t10-,11?,12?,18+/m0/s1 |
| InChIKey | UHOYTSKPXXHTPI-YNBRJMTKSA-N |
| XLogP | 2.53 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |