About 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole
3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole (PubChem CID 12062701) has the molecular formula C14H15N3O
and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole |
| PubChem CID | 12062701 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole |
| SMILES | Cc1cc(C)n(CCc2noc3ccccc23)n1 |
| InChI | InChI=1S/C14H15N3O/c1-10-9-11(2)17(15-10)8-7-13-12-5-3-4-6-14(12)18-16-13/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | ANXMYMGTPXOVND-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole?
The IUPAC name of 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole (CID 12062701) is 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole.
What is the SMILES notation for 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole?
The canonical SMILES for 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole is Cc1cc(C)n(CCc2noc3ccccc23)n1.
What is the InChIKey of 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole?
The InChIKey is ANXMYMGTPXOVND-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O/c1-10-9-11(2)17(15-10)8-7-13-12-5-3-4-6-14(12)18-16-13/h3-6,9H,7-8H2,1-2H3.
What are the key properties of 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole?
3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole has a molecular weight of 241.29 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-1,2-benzoxazole is sourced from PubChem (CID 12062701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).