C17H19N3O4S — CID 120627148
(3aS,7aS)-2-(1-methyl-3-thiophen-2-ylpyrazole-4-carbonyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120627148) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is (3aS,7aS)-2-(1-methyl-3-thiophen-2-ylpyrazole-4-carbonyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-(1-methyl-3-thiophen-2-ylpyrazole-4-carbonyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120627148 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (3aS,7aS)-2-(1-methyl-3-thiophen-2-ylpyrazole-4-carbonyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | Cn1cc(C(=O)N2C[C@H]3COCC[C@@]3(C(=O)O)C2)c(-c2cccs2)n1 |
| InChI | InChI=1S/C17H19N3O4S/c1-19-8-12(14(18-19)13-3-2-6-25-13)15(21)20-7-11-9-24-5-4-17(11,10-20)16(22)23/h2-3,6,8,11H,4-5,7,9-10H2,1H3,(H,22,23)/t11-,17+/m0/s1 |
| InChIKey | QMKPALJFVMDQBX-APPDUMDISA-N |
| XLogP | 1.71 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |