C20H26O2S2 — CID 12062721
benzyl (E)-3-[1-(1,3-dithian-2-yl)cyclohexyl]prop-2-enoate (PubChem CID 12062721) has the molecular formula C20H26O2S2 and a molecular weight of 362.56 g/mol. Its IUPAC name is benzyl (E)-3-[1-(1,3-dithian-2-yl)cyclohexyl]prop-2-enoate.
| Compound Name | benzyl (E)-3-[1-(1,3-dithian-2-yl)cyclohexyl]prop-2-enoate |
|---|---|
| PubChem CID | 12062721 |
| Molecular Formula | C20H26O2S2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | benzyl (E)-3-[1-(1,3-dithian-2-yl)cyclohexyl]prop-2-enoate |
| SMILES | O=C(/C=C/C1(C2SCCCS2)CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C20H26O2S2/c21-18(22-16-17-8-3-1-4-9-17)10-13-20(11-5-2-6-12-20)19-23-14-7-15-24-19/h1,3-4,8-10,13,19H,2,5-7,11-12,14-16H2/b13-10+ |
| InChIKey | MRKKQTWBVNCURE-JLHYYAGUSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|