C18H23NO6 — CID 120627514
(3aS,7aS)-2-[4-(2-methoxyethoxy)benzoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120627514) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is (3aS,7aS)-2-[4-(2-methoxyethoxy)benzoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[4-(2-methoxyethoxy)benzoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120627514 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (3aS,7aS)-2-[4-(2-methoxyethoxy)benzoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | COCCOc1ccc(C(=O)N2C[C@H]3COCC[C@@]3(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C18H23NO6/c1-23-8-9-25-15-4-2-13(3-5-15)16(20)19-10-14-11-24-7-6-18(14,12-19)17(21)22/h2-5,14H,6-12H2,1H3,(H,21,22)/t14-,18+/m0/s1 |
| InChIKey | IAXWEJFVWTWKLH-KBXCAEBGSA-N |
| XLogP | 1.28 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|