C14H24N2O6S — CID 120627516
(3aS,7aS)-2-[2-(diethylsulfamoyl)acetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120627516) has the molecular formula C14H24N2O6S and a molecular weight of 348.42 g/mol. Its IUPAC name is (3aS,7aS)-2-[2-(diethylsulfamoyl)acetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[2-(diethylsulfamoyl)acetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120627516 |
| Molecular Formula | C14H24N2O6S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (3aS,7aS)-2-[2-(diethylsulfamoyl)acetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | CCN(CC)S(=O)(=O)CC(=O)N1C[C@H]2COCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C14H24N2O6S/c1-3-16(4-2)23(20,21)9-12(17)15-7-11-8-22-6-5-14(11,10-15)13(18)19/h11H,3-10H2,1-2H3,(H,18,19)/t11-,14+/m0/s1 |
| InChIKey | QJHQEEIOLBOSHP-SMDDNHRTSA-N |
| XLogP | -0.39 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |