C17H21NO5S — CID 120627714
(3aS,7aS)-2-[2-(3-methoxyphenyl)sulfanylacetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120627714) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is (3aS,7aS)-2-[2-(3-methoxyphenyl)sulfanylacetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[2-(3-methoxyphenyl)sulfanylacetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120627714 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (3aS,7aS)-2-[2-(3-methoxyphenyl)sulfanylacetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | COc1cccc(SCC(=O)N2C[C@H]3COCC[C@@]3(C(=O)O)C2)c1 |
| InChI | InChI=1S/C17H21NO5S/c1-22-13-3-2-4-14(7-13)24-10-15(19)18-8-12-9-23-6-5-17(12,11-18)16(20)21/h2-4,7,12H,5-6,8-11H2,1H3,(H,20,21)/t12-,17+/m0/s1 |
| InChIKey | IENIXHVXAZLGMD-YVEFUNNKSA-N |
| XLogP | 1.74 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |