C16H17ClFNO4 — CID 120627757
(3aS,7aS)-2-[2-(2-chloro-6-fluorophenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120627757) has the molecular formula C16H17ClFNO4 and a molecular weight of 341.77 g/mol. Its IUPAC name is (3aS,7aS)-2-[2-(2-chloro-6-fluorophenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[2-(2-chloro-6-fluorophenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120627757 |
| Molecular Formula | C16H17ClFNO4 |
| Molecular Weight | 341.77 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (3aS,7aS)-2-[2-(2-chloro-6-fluorophenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(Cc1c(F)cccc1Cl)N1C[C@H]2COCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C16H17ClFNO4/c17-12-2-1-3-13(18)11(12)6-14(20)19-7-10-8-23-5-4-16(10,9-19)15(21)22/h1-3,10H,4-9H2,(H,21,22)/t10-,16+/m0/s1 |
| InChIKey | AQLIDHNWOCXTLC-MGPLVRAMSA-N |
| XLogP | 1.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.77 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |