C19H22FNO4 — CID 120627854
(3aS,7aS)-2-[1-(3-fluorophenyl)cyclobutanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120627854) has the molecular formula C19H22FNO4 and a molecular weight of 347.39 g/mol. Its IUPAC name is (3aS,7aS)-2-[1-(3-fluorophenyl)cyclobutanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[1-(3-fluorophenyl)cyclobutanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120627854 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (3aS,7aS)-2-[1-(3-fluorophenyl)cyclobutanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(N1C[C@H]2COCC[C@@]2(C(=O)O)C1)C1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C19H22FNO4/c20-15-4-1-3-13(9-15)18(5-2-6-18)16(22)21-10-14-11-25-8-7-19(14,12-21)17(23)24/h1,3-4,9,14H,2,5-8,10-12H2,(H,23,24)/t14-,19+/m0/s1 |
| InChIKey | UUBUSTLUWZPZNW-IFXJQAMLSA-N |
| XLogP | 2.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |