C14H17BrN2O4 — CID 120629001
(3aS,7aS)-2-(4-bromo-1-methylpyrrole-2-carbonyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120629001) has the molecular formula C14H17BrN2O4 and a molecular weight of 357.20 g/mol. Its IUPAC name is (3aS,7aS)-2-(4-bromo-1-methylpyrrole-2-carbonyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-(4-bromo-1-methylpyrrole-2-carbonyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120629001 |
| Molecular Formula | C14H17BrN2O4 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | (3aS,7aS)-2-(4-bromo-1-methylpyrrole-2-carbonyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | Cn1cc(Br)cc1C(=O)N1C[C@H]2COCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C14H17BrN2O4/c1-16-6-10(15)4-11(16)12(18)17-5-9-7-21-3-2-14(9,8-17)13(19)20/h4,6,9H,2-3,5,7-8H2,1H3,(H,19,20)/t9-,14+/m0/s1 |
| InChIKey | QEPVJKYPAJPBFD-LKFCYVNXSA-N |
| XLogP | 1.35 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |