C22H28N2O3 — CID 120629843
4-(methoxymethyl)-N-[1-(4-phenoxyphenyl)ethyl]piperidine-4-carboxamide (PubChem CID 120629843) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 4-(methoxymethyl)-N-[1-(4-phenoxyphenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 4-(methoxymethyl)-N-[1-(4-phenoxyphenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120629843 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 4-(methoxymethyl)-N-[1-(4-phenoxyphenyl)ethyl]piperidine-4-carboxamide |
| SMILES | COCC1(C(=O)NC(C)c2ccc(Oc3ccccc3)cc2)CCNCC1 |
| InChI | InChI=1S/C22H28N2O3/c1-17(24-21(25)22(16-26-2)12-14-23-15-13-22)18-8-10-20(11-9-18)27-19-6-4-3-5-7-19/h3-11,17,23H,12-16H2,1-2H3,(H,24,25) |
| InChIKey | DANZFRIKSANTTA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |