About 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide
2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide (PubChem CID 120630074) has the molecular formula C15H17F2N3OS
and a molecular weight of 325.38 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 120630074 |
| Molecular Formula | C15H17F2N3OS |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide |
| SMILES | CCN(Cc1c(F)cccc1F)C(=O)c1csc(CCN)n1 |
| InChI | InChI=1S/C15H17F2N3OS/c1-2-20(8-10-11(16)4-3-5-12(10)17)15(21)13-9-22-14(19-13)6-7-18/h3-5,9H,2,6-8,18H2,1H3 |
| InChIKey | FYMRCPXFKJTKHM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide (CID 120630074) is 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide is CCN(Cc1c(F)cccc1F)C(=O)c1csc(CCN)n1.
What is the InChIKey of 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide?
The InChIKey is FYMRCPXFKJTKHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2N3OS/c1-2-20(8-10-11(16)4-3-5-12(10)17)15(21)13-9-22-14(19-13)6-7-18/h3-5,9H,2,6-8,18H2,1H3.
What are the key properties of 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide?
2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide has a molecular weight of 325.38 g/mol, XLogP of 2.58, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)-N-[(2,6-difluorophenyl)methyl]-N-ethyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 120630074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).