C18H27ClN2O — CID 120630325
(2S,4S)-N-[3-(4-chlorophenyl)pentan-3-yl]-2-methylpiperidine-4-carboxamide (PubChem CID 120630325) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is (2S,4S)-N-[3-(4-chlorophenyl)pentan-3-yl]-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-[3-(4-chlorophenyl)pentan-3-yl]-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120630325 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (2S,4S)-N-[3-(4-chlorophenyl)pentan-3-yl]-2-methylpiperidine-4-carboxamide |
| SMILES | CCC(CC)(NC(=O)[C@H]1CCN[C@@H](C)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H27ClN2O/c1-4-18(5-2,15-6-8-16(19)9-7-15)21-17(22)14-10-11-20-13(3)12-14/h6-9,13-14,20H,4-5,10-12H2,1-3H3,(H,21,22)/t13-,14-/m0/s1 |
| InChIKey | BUEPXCFPYCWJJI-KBPBESRZSA-N |
| XLogP | 3.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |